CAS 59524-02-6 appears in our catalog under these names: Boc–Ser–OBzl, Boc-L-Ser-OBzl, N-Boc-L-serine benzyl ester, 95% , BOC-L-Serine benzyl ester, 98%, Boc-Ser-OBzl 98%. Offered by: GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Thermo Scientific (Acros), Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 1000g, 50g, 250g, 500g.
Benzyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 59524-02-6) is a chemical compound with the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. IUPAC name: benzyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: BQADRZHPZVQGCW-LBPRGKRZSA-N.
| Molecular formula | C15H21NO5 |
|---|---|
| Molecular weight | 295.33 g/mol |
| IUPAC name | benzyl (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | BQADRZHPZVQGCW-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)