cas: 73259-81-1 — see every product listed under this CAS number, including other names
Boc-Dap-OH 97% (CAS 73259-81-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100715-1g |
| cas | 73259-81-1 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 298.06 Pln | |
| Ambeed | 100g | 871.00 Pln | |
| Ambeed | 500g | 4069.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A100715 |
(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 73259-81-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)