cas: 73259-81-1 — see every product listed under this CAS number, including other names
Boc-Dap-OH, 97% (CAS 73259-81-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A100715-1kg |
| cas | 73259-81-1 |
| size | 1kg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1kg | 6945.25 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 225.75 Pln | |
| Ambeed | 25g | 303.62 Pln | |
| Ambeed | 100g | 882.12 Pln | |
| Ambeed | 500g | 4113.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 73259-81-1) is a chemical compound with the molecular formula C8H16N2O4 and a molecular weight of 204.22 g/mol. IUPAC name: (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KRJLRVZLNABMAT-YFKPBYRVSA-N.
| Molecular formula | C8H16N2O4 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S)-3-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KRJLRVZLNABMAT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CN)C(=O)O |
Computed by PubChem (NCBI)