cas: 133906-29-3 — see every product listed under this CAS number, including other names
Boc-Glu-Ofm, 98%, 98% (CAS 133906-29-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11918J-100mg |
| cas | 133906-29-3 |
| size | 100mg |
| availability | 100g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 626.00 Pln | |
| Chemat | 10g | 1024.40 Pln | |
| Chemat | 25g | 2042.00 Pln | |
| Chemat | 50g | 3659.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4S)-5-(9H-fluoren-9-ylmethoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid (CAS 133906-29-3) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: (4S)-5-(9H-fluoren-9-ylmethoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid. InChIKey: KSYVYHUPZNONJS-FQEVSTJZSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | (4S)-5-(9H-fluoren-9-ylmethoxy)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoic acid |
| InChIKey | KSYVYHUPZNONJS-FQEVSTJZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)