cas: 77611-37-1 — see every product listed under this CAS number, including other names
Boc-L-6-Hydroxynorleucine, 95% (CAS 77611-37-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211940-250MG |
| cas | 77611-37-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1497.41 Pln | |
| Fluorochem | 25g | 4985.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 77611-37-1) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: BRFDKSWARKFUGQ-QMMMGPOBSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | (2S)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | BRFDKSWARKFUGQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCO)C(=O)O |
Computed by PubChem (NCBI)