Products 1359971-57-5

CAS 1359971-57-5 is the registry number for Boc-D-Nle(6-OH)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

(2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 1359971-57-5) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: (2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: BRFDKSWARKFUGQ-MRVPVSSYSA-N.

Identity
Molecular formulaC11H21NO5
Molecular weight247.29 g/mol
IUPAC name(2R)-6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
InChIKeyBRFDKSWARKFUGQ-MRVPVSSYSA-N
SMILESCC(C)(C)OC(=O)N[C@H](CCCCO)C(=O)O

Computed by PubChem (NCBI)