cas: 30925-11-2 — see every product listed under this CAS number, including other names
Boc-N-Me-Phg-OH, 98% (CAS 30925-11-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A133537-250mg |
| cas | 30925-11-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 1421.69 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 2066.00 Pln | |
| BLDpharm | 250mg | 258.82 Pln | |
| BLDpharm | 1g | 547.61 Pln | |
| BLDpharm | 5g | 1525.04 Pln | |
| Fluorochem | 1g | 1237.08 Pln | |
| Fluorochem | 5g | 3819.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid (CAS 30925-11-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid. InChIKey: COABPHLHHQAKPL-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-phenylacetic acid |
| InChIKey | COABPHLHHQAKPL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@@H](C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)