cas: 201217-86-9 — see every product listed under this CAS number, including other names
Boc-O-tert-butyl-D-threonine, 97%, 97% (CAS 201217-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113D0L-100mg |
| cas | 201217-86-9 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 342.80 Pln | |
| Chemat | 10g | 582.80 Pln | |
| Chemat | 25g | 1101.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 201217-86-9) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LKRXXARJBFBMCE-DTWKUNHWSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2R,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LKRXXARJBFBMCE-DTWKUNHWSA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)