CAS 474334-59-3 is the registry number for (2S,3S)-3-(tert-Butoxy)-2-{[(tert-butoxy)carbonyl]amino}butanoic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 474334-59-3) is a chemical compound with the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. IUPAC name: (2S,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: LKRXXARJBFBMCE-IUCAKERBSA-N.
| Molecular formula | C13H25NO5 |
|---|---|
| Molecular weight | 275.34 g/mol |
| IUPAC name | (2S,3S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | LKRXXARJBFBMCE-IUCAKERBSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)