Boc-Oamb-OH 98%
cas: 669713-61-5 — see every product listed under this CAS number, including other names
Boc-Oamb-OH 98% (CAS 669713-61-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A964134-100mg |
| cas | 669713-61-5 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 815.38 Pln | |
| Ambeed | 5g | 3435.31 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A964134 |
2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid (CAS 669713-61-5) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid. InChIKey: GWVKDNNYKKKOHC-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid |
| InChIKey | GWVKDNNYKKKOHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C1=CC=CC=C1C(=O)O)N |
Computed by PubChem (NCBI)