Products 669713-61-5
CAS 669713-61-5 appears in our catalog under these names: 2-(Boc-aminomethyl)benzoic acid, 97%, Boc-2-Amb-OH, 2-(Boc-aminomethyl)benzoic acid, Boc-Oamb-OH 98%, 2-(BOC-AMINOMETHYL)BENZOIC ACID, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 500mg, 1000mg, 2000mg, 5000mg.
2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid (CAS 669713-61-5) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid. InChIKey: GWVKDNNYKKKOHC-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 2-[1-amino-2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]benzoic acid |
| InChIKey | GWVKDNNYKKKOHC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C1=CC=CC=C1C(=O)O)N |
Computed by PubChem (NCBI)