Boc-Oxyma, 98%, 98%
cas: 1426821-11-5 — see every product listed under this CAS number, including other names
Boc-Oxyma, 98%, 98% (CAS 1426821-11-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BCV-1g |
| cas | 1426821-11-5 |
| size | 1g |
| availability | 500g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 112.40 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 25g | 338.00 Pln | |
| Chemat | 100g | 1154.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate (CAS 1426821-11-5) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate. InChIKey: GTIPXWMOYWXFBG-KPKJPENVSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate |
| InChIKey | GTIPXWMOYWXFBG-KPKJPENVSA-N |
| SMILES | CCOC(=O)/C(=N/OC(=O)OC(C)(C)C)/C#N |
Computed by PubChem (NCBI)