CAS 1426821-11-5 appears in our catalog under these names: Boc-oxyma, 98%, Boc-Oxyma, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g.
Ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate (CAS 1426821-11-5) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate. InChIKey: GTIPXWMOYWXFBG-KPKJPENVSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl (2E)-2-cyano-2-[(2-methylpropan-2-yl)oxycarbonyloxyimino]acetate |
| InChIKey | GTIPXWMOYWXFBG-KPKJPENVSA-N |
| SMILES | CCOC(=O)/C(=N/OC(=O)OC(C)(C)C)/C#N |
Computed by PubChem (NCBI)