CAS 182120-90-7 appears in our catalog under these names: 2-([(tert-Butoxycarbonyl)amino]methyl)-1,3-oxazole-4-carboxylic acid, 95%, 2-((tert-Butoxycarbonylamino)methyl)oxazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 0,5g, 0,25g, 1g, 5g, 2g.
2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-oxazole-4-carboxylic acid (CAS 182120-90-7) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-oxazole-4-carboxylic acid. InChIKey: AKUIDVVQFDMLAW-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-oxazole-4-carboxylic acid |
| InChIKey | AKUIDVVQFDMLAW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=NC(=CO1)C(=O)O |
Computed by PubChem (NCBI)