CAS 65358-15-8 appears in our catalog under these names: Pseudothymidine, 95%, Pseudothymidine, Pseudothymidine, 99.44%, 99.44%, Pseudothymidine, 99.44%, Pseudothymidine (Standard). Offered by: Combi-blocks, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 1mg, 5 mg, 25 mg.
5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione (CAS 65358-15-8) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione. InChIKey: AMDJRICBYOAHBZ-XLPZGREQSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 5-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpyrimidine-2,4-dione |
| InChIKey | AMDJRICBYOAHBZ-XLPZGREQSA-N |
| SMILES | CN1C=C(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)