CAS 24514-32-7 appears in our catalog under these names: 2'-Deoxy-3-methyluridine, 98+%, 2'-Deoxy-N3-methyluridine, >95% (HPLC), 2'-Deoxy-N3-methyluridine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 100mg, 500mg, 250mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione (CAS 24514-32-7) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione. InChIKey: ZTSLSWUGHMGGCM-LKEWCRSYSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-methylpyrimidine-2,4-dione |
| InChIKey | ZTSLSWUGHMGGCM-LKEWCRSYSA-N |
| SMILES | CN1C(=O)C=CN(C1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)