Products 1820569-56-9
CAS 1820569-56-9 is the registry number for hydrate methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrate (CAS 1820569-56-9) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrate. InChIKey: STMRJPFXZFJSNC-SBSPUUFOSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-nitrophenyl)propanoate;hydrate |
| InChIKey | STMRJPFXZFJSNC-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)[N+](=O)[O-])N.O |
Computed by PubChem (NCBI)