cas: 13734-34-4 — see every product listed under this CAS number, including other names
Boc-Phe-OH, 98% (CAS 13734-34-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g, 100g, 250g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03310-10G |
| cas | 13734-34-4 |
| size | 10g |
| availability | In Stock Germany |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 100g | 117.68 Pln | |
| Fluorochem | 250g | 211.40 Pln | |
| Fluorochem | 500g | 305.12 Pln | |
| Fluorochem | 1kg | 544.62 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 13734-34-4) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: ZYJPUMXJBDHSIF-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | ZYJPUMXJBDHSIF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)