cas: 51293-47-1 — see every product listed under this CAS number, including other names
Boc-Ser(Me)-OH, 97%, 97% (CAS 51293-47-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDWK-250mg |
| cas | 51293-47-1 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 722.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 51293-47-1) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC)C(=O)O |
Computed by PubChem (NCBI)