cas: 51293-47-1 — see every product listed under this CAS number, including other names
Boc-Ser(Me)-OH, 97.0% (CAS 51293-47-1) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 10 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008022-25 g |
| cas | 51293-47-1 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 319.69 Pln | |
| MedChemExpress | 10 g | 240.74 Pln | |
| MedChemExpress | 100 g | 928.06 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 51293-47-1) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 219.23 g/mol. IUPAC name: (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: RFGMSGRWQUMJIR-LURJTMIESA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 219.23 g/mol |
| IUPAC name | (2S)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | RFGMSGRWQUMJIR-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC)C(=O)O |
Computed by PubChem (NCBI)