cas: 851653-36-6 — see every product listed under this CAS number, including other names
Boc-aza-DL-Leu-OH 95% (CAS 851653-36-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A905337-250mg |
| cas | 851653-36-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 1249.25 Pln | |
| Ambeed | 5g | 5515.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A905337 |
3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 851653-36-6) is a chemical compound with the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. IUPAC name: 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VCDQZVYJKDSORW-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O4 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | 3-(dimethylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VCDQZVYJKDSORW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CN(C)C)C(=O)O |
Computed by PubChem (NCBI)