cas: 35264-09-6 — see every product listed under this CAS number, including other names
Boc-cycloleucine, 95%, 95% (CAS 35264-09-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EJW-100g |
| cas | 35264-09-6 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 923.60 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 275.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid (CAS 35264-09-6) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid. InChIKey: YBZCSKVLXBOFSL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentane-1-carboxylic acid |
| InChIKey | YBZCSKVLXBOFSL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCCC1)C(=O)O |
Computed by PubChem (NCBI)