cas: 114873-00-6 — see every product listed under this CAS number, including other names
Boc-l-2-Fluorophenylalanine, 98% (CAS 114873-00-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008082-1G |
| cas | 114873-00-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 268.67 Pln | |
| Fluorochem | 25g | 591.48 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 114873-00-6) is a chemical compound with the molecular formula C14H18FNO4 and a molecular weight of 283.29 g/mol. IUPAC name: (2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NTWUXBKUDXGMHV-NSHDSACASA-N.
| Molecular formula | C14H18FNO4 |
|---|---|
| Molecular weight | 283.29 g/mol |
| IUPAC name | (2S)-3-(2-fluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NTWUXBKUDXGMHV-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1F)C(=O)O |
Computed by PubChem (NCBI)