cas: 39567-17-4 — see every product listed under this CAS number, including other names
Butanoic acid, 3-oxo-, diphenylmethyl ester, 95%+, 95%+ (CAS 39567-17-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11890C-250mg |
| cas | 39567-17-4 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
Benzhydryl 3-oxobutanoate (CAS 39567-17-4) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: benzhydryl 3-oxobutanoate. InChIKey: SCKHRWLYBIIXNO-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | benzhydryl 3-oxobutanoate |
| InChIKey | SCKHRWLYBIIXNO-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OC(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)