CAS 420823-80-9 appears in our catalog under these names: 1-(2-Hydroxy-4-methylphenyl)-3-(3-methylphenyl)propane-1,3-dione, 95%, 1-(2-Hydroxy-4-methylphenyl)-3-(m-tolyl)propane-1,3-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(2-hydroxy-4-methylphenyl)-3-(3-methylphenyl)propane-1,3-dione (CAS 420823-80-9) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: 1-(2-hydroxy-4-methylphenyl)-3-(3-methylphenyl)propane-1,3-dione. InChIKey: FBZYHQIKJSWEER-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 1-(2-hydroxy-4-methylphenyl)-3-(3-methylphenyl)propane-1,3-dione |
| InChIKey | FBZYHQIKJSWEER-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)CC(=O)C2=C(C=C(C=C2)C)O |
Computed by PubChem (NCBI)