CAS 173865-33-3 appears in our catalog under these names: CDD3505/ 99.39% (existing batch purity), CDD3505, CDD3505, ≥99%, ≥99%, CDD3505, 98.0%, CDD3505 (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
4-nitro-1-tritylimidazole (CAS 173865-33-3) is a chemical compound with the molecular formula C22H17N3O2 and a molecular weight of 355.4 g/mol. IUPAC name: 4-nitro-1-tritylimidazole. InChIKey: MUQGVERJAKANJN-UHFFFAOYSA-N.
| Molecular formula | C22H17N3O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 4-nitro-1-tritylimidazole |
| InChIKey | MUQGVERJAKANJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)