CAS 305357-89-5 appears in our catalog under these names: GLUT1–IN–2, CHEMBL1276927/ 99.25% (existing batch purity), N-(3-(1H-Benzo[d]imidazol-2-yl)phenyl)-3-methylbenzamide, 95%, 95%, GLUT1-IN-2, 98.03%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
N-[3-(1H-benzimidazol-2-yl)phenyl]-3-methylbenzamide (CAS 305357-89-5) is a chemical compound with the molecular formula C21H17N3O and a molecular weight of 327.4 g/mol. IUPAC name: N-[3-(1H-benzimidazol-2-yl)phenyl]-3-methylbenzamide. InChIKey: BFAZKDZNMRHORZ-UHFFFAOYSA-N.
| Molecular formula | C21H17N3O |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | N-[3-(1H-benzimidazol-2-yl)phenyl]-3-methylbenzamide |
| InChIKey | BFAZKDZNMRHORZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC=CC(=C2)C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)