Products 544450-68-2
CAS 544450-68-2 appears in our catalog under these names: COR659/ 99.56% (existing batch purity), COR659, Methyl 2-(4-chlorobenzamido)-4-ethyl-5-methylthiophene-3-carboxylate, 98%, 98%, COR659, 99.94%, 2-(4-Chloro-benzoylamino)-4-ethyl-5-methyl-th iophene-3-carboxylic acid methyl ester, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
Methyl 2-[(4-chlorobenzoyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate (CAS 544450-68-2) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: methyl 2-[(4-chlorobenzoyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate. InChIKey: AAFLALGGEYRGTR-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | methyl 2-[(4-chlorobenzoyl)amino]-4-ethyl-5-methylthiophene-3-carboxylate |
| InChIKey | AAFLALGGEYRGTR-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC(=C1C(=O)OC)NC(=O)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)