cas: 51828-95-6 — see every product listed under this CAS number, including other names
Calcium 4-methyl-2-oxopentanoate, 97% (contains 11% H2O), 97% (contains 11% H2O) (CAS 51828-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ONG-1g |
| cas | 51828-95-6 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 438.80 Pln |
| purity | 97% (contains 11% H2O) |
|---|---|
| delivery time | 3 weeks |
Calcium bis(4-methyl-2-oxopentanoate) (CAS 51828-95-6) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis(4-methyl-2-oxopentanoate). InChIKey: WQZNGJIBHXYVNW-UHFFFAOYSA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis(4-methyl-2-oxopentanoate) |
| InChIKey | WQZNGJIBHXYVNW-UHFFFAOYSA-L |
| SMILES | CC(C)CC(=O)C(=O)[O-].CC(C)CC(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)