cas: 51828-95-6 — see every product listed under this CAS number, including other names
Calcium 4-methyl-2-oxopentanoate (CAS 51828-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F463031-1G |
| cas | 51828-95-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 25g | 830.98 Pln | |
| Fluorochem | 100g | 2143.01 Pln |
| delivery time | 3-4 weeks |
|---|
Calcium bis(4-methyl-2-oxopentanoate) (CAS 51828-95-6) is a chemical compound with the molecular formula C12H18CaO6 and a molecular weight of 298.35 g/mol. IUPAC name: calcium bis(4-methyl-2-oxopentanoate). InChIKey: WQZNGJIBHXYVNW-UHFFFAOYSA-L.
| Molecular formula | C12H18CaO6 |
|---|---|
| Molecular weight | 298.35 g/mol |
| IUPAC name | calcium bis(4-methyl-2-oxopentanoate) |
| InChIKey | WQZNGJIBHXYVNW-UHFFFAOYSA-L |
| SMILES | CC(C)CC(=O)C(=O)[O-].CC(C)CC(=O)C(=O)[O-].[Ca+2] |
Computed by PubChem (NCBI)