Products 192203-60-4
CAS 192203-60-4 appears in our catalog under these names: Carboxypeptidase G2 (CPG2) Inhibitor/ 99.69% (existing batch purity), Carboxypeptidase G2 (CPG2) Inhibitor, 98.02%, Carboxypeptidase G2 Inhibitor. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(2S)-2-[(4-methoxyphenyl)sulfanylcarbonylamino]pentanedioic acid (CAS 192203-60-4) is a chemical compound with the molecular formula C13H15NO6S and a molecular weight of 313.33 g/mol. IUPAC name: (2S)-2-[(4-methoxyphenyl)sulfanylcarbonylamino]pentanedioic acid. InChIKey: OBCGYIKABKFIQB-JTQLQIEISA-N.
| Molecular formula | C13H15NO6S |
|---|---|
| Molecular weight | 313.33 g/mol |
| IUPAC name | (2S)-2-[(4-methoxyphenyl)sulfanylcarbonylamino]pentanedioic acid |
| InChIKey | OBCGYIKABKFIQB-JTQLQIEISA-N |
| SMILES | COC1=CC=C(C=C1)SC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)