CAS 851871-94-8 appears in our catalog under these names: Casein kinase 1δ-IN-1/ 99.46% (existing batch purity), Casein kinase 1δ–IN–1, N-(3-Cyanothiophen-2-yl)picolinamide, 98%, 98%, Casein kinase 1δ-IN-1, 99.91%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL, 50 mg.
N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide (CAS 851871-94-8) is a chemical compound with the molecular formula C11H7N3OS and a molecular weight of 229.26 g/mol. IUPAC name: N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide. InChIKey: XNEHUAKGYXQSBF-UHFFFAOYSA-N.
| Molecular formula | C11H7N3OS |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | N-(3-cyanothiophen-2-yl)pyridine-2-carboxamide |
| InChIKey | XNEHUAKGYXQSBF-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C(=O)NC2=C(C=CS2)C#N |
Computed by PubChem (NCBI)