Cbz-4-ABCbz-OH 95%
cas: 5330-71-2 — see every product listed under this CAS number, including other names
Cbz-4-ABCbz-OH 95% (CAS 5330-71-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A915221-1g |
| cas | 5330-71-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 142.31 Pln | |
| Ambeed | 25g | 314.75 Pln | |
| Ambeed | 100g | 1037.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A915221 |
4-(phenylmethoxycarbonylamino)benzoic acid (CAS 5330-71-2) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 4-(phenylmethoxycarbonylamino)benzoic acid. InChIKey: XRKLFEVNZWRMCT-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 4-(phenylmethoxycarbonylamino)benzoic acid |
| InChIKey | XRKLFEVNZWRMCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-(((Benzyloxy)carbonyl)amino)benzoic acid, 4-(benzyloxycarbonylamino)benzoic acid, 4-{[(benzyloxy)carbonyl]amino}benzoic acid, 4-(Cbz-amino)benzoic acid, 4-(phenylmethoxycarbonylamino)benzoic acid, Benzoic acid, 4-[[(phenylmethoxy)carbonyl]amino]- (9CI), Z-(4)Abz-OH, Cbz-4-ABCbz-OH, Oprea1_655434, XRKLFEVNZWRMCT-UHFFFAOYSA-N