cas: 29880-22-6 — see every product listed under this CAS number, including other names
Cbz-DL-Asn-OH 98% (CAS 29880-22-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1482464-5g |
| cas | 29880-22-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 776.44 Pln | |
| Ambeed | 500g | 2333.94 Pln | |
| Ambeed | 1000g | 4091.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1482464 |
4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 29880-22-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)