CAS 29880-22-6 appears in our catalog under these names: 4–Amino–2–(Cbz–amino)–4–oxobutyric Acid, Nalpha-Carbobenzoxy-DL-asparagine, >99.0%(T), Cbz-DL-Asn-OH 98%, Cbz-DL-Asn-OH 98.0%, 4-Amino-2-(Cbz-amino)-4-oxobutyric Acid, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 10g, 5g, 500g, 1000g, 1kg.
4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid (CAS 29880-22-6) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: FUCKRCGERFLLHP-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-amino-4-oxo-2-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | FUCKRCGERFLLHP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC(CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)