cas: 328565-16-8 — see every product listed under this CAS number, including other names
Col003, 99.46% (CAS 328565-16-8) is a chemical reagent available from Chemat. Available pack sizes: 50 mg, 10 mg, 100 mg, 25 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-124817-50 mg |
| cas | 328565-16-8 |
| size | 50 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 mg | 2279.46 Pln | |
| MedChemExpress | 10 mg | 765.52 Pln | |
| MedChemExpress | 100 mg | 3477.61 Pln | |
| MedChemExpress | 25 mg | 1462.12 Pln | |
| MedChemExpress | 5 mg | 505.45 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.46% |
5-benzyl-2-hydroxy-3-nitrobenzaldehyde (CAS 328565-16-8) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 5-benzyl-2-hydroxy-3-nitrobenzaldehyde. InChIKey: RKJXVCLOGNLZOI-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 5-benzyl-2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | RKJXVCLOGNLZOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C(=C2)[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)