cas: 328565-16-8 — see every product listed under this CAS number, including other names
Col003 (CAS 328565-16-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 1mg, 200mg. Offered by: Biosynth, Chemat.
| brand | Biosynth |
|---|---|
| catalog number | DNA56516-10mg |
| cas | 328565-16-8 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 10mg | price on request | |
| Biosynth | 5mg | price on request | |
| Biosynth | 25mg | price on request | |
| Biosynth | 50mg | price on request | |
| Biosynth | 100mg | price on request | |
| Chemat | 1mg | 256.40 Pln | |
| Chemat | 5mg | 506.00 Pln | |
| Chemat | 10mg | 803.60 Pln | |
| Chemat | 50mg | 2622.80 Pln | |
| Chemat | 100mg | 3717.20 Pln | |
| Chemat | 25mg | 1653.20 Pln | |
| Chemat | 200mg | 5070.80 Pln |
| category | Life Sciences |
|---|---|
| purity | No data |
| delivery time | 3-4 Weeks |
5-benzyl-2-hydroxy-3-nitrobenzaldehyde (CAS 328565-16-8) is a chemical compound with the molecular formula C14H11NO4 and a molecular weight of 257.24 g/mol. IUPAC name: 5-benzyl-2-hydroxy-3-nitrobenzaldehyde. InChIKey: RKJXVCLOGNLZOI-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 5-benzyl-2-hydroxy-3-nitrobenzaldehyde |
| InChIKey | RKJXVCLOGNLZOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=C(C(=C2)[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)