cas: 52662-00-7 — see every product listed under this CAS number, including other names
Cyclo(Gly-Gln), 98+%, 98+% (CAS 52662-00-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148Q7-100mg |
| cas | 52662-00-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 736.40 Pln | |
| Chemat | 1g | 1878.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
3-[(2S)-3,6-dioxopiperazin-2-yl]propanamide (CAS 52662-00-7) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: 3-[(2S)-3,6-dioxopiperazin-2-yl]propanamide. InChIKey: PWADXPITHGKDSY-BYPYZUCNSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 3-[(2S)-3,6-dioxopiperazin-2-yl]propanamide |
| InChIKey | PWADXPITHGKDSY-BYPYZUCNSA-N |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CCC(=O)N |
Computed by PubChem (NCBI)