CAS 1881293-69-1 is the registry number for N,N-dimethyl-5-nitropyridin-2-amine hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N,N-dimethyl-5-nitropyridin-2-amine;hydrate (CAS 1881293-69-1) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: N,N-dimethyl-5-nitropyridin-2-amine;hydrate. InChIKey: JFRXRHFFYKOZAT-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | N,N-dimethyl-5-nitropyridin-2-amine;hydrate |
| InChIKey | JFRXRHFFYKOZAT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC=C(C=C1)[N+](=O)[O-].O |
Computed by PubChem (NCBI)