CAS 1383814-73-0 is the registry number for (1S,2R,5S)-6-Hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5S)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (CAS 1383814-73-0) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: (2R,5S)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide. InChIKey: PRLUPQAHAOHPQZ-CRCLSJGQSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | (2R,5S)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| InChIKey | PRLUPQAHAOHPQZ-CRCLSJGQSA-N |
| SMILES | C1C[C@@H](N2C[C@H]1N(C2=O)O)C(=O)N |
Computed by PubChem (NCBI)