CAS 55559-70-1 is the registry number for Cidofovir Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-2-one (CAS 55559-70-1) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: 4-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-2-one. InChIKey: LTTDCEYZEHQDGW-YFKPBYRVSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 4-amino-1-[(2S)-2,3-dihydroxypropyl]pyrimidin-2-one |
| InChIKey | LTTDCEYZEHQDGW-YFKPBYRVSA-N |
| SMILES | C1=CN(C(=O)N=C1N)C[C@@H](CO)O |
Computed by PubChem (NCBI)