CAS 56750-04-0 appears in our catalog under these names: Metronidazole Impurity 1, Ornidazole Impurity 54, Metronidazole Impurity 5, Metronidazole Impurity 10, ²,2-Dimethyl-5-nitro-1H-imidazole-1-ethanol. Offered by: Chemat Brand, Hubei YoungXin, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol (CAS 56750-04-0) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: 2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol. InChIKey: QBBJCFDTZBBBRB-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2-(2-methyl-5-nitroimidazol-1-yl)propan-1-ol |
| InChIKey | QBBJCFDTZBBBRB-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(N1C(C)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)