Products 1311316-60-5
CAS 1311316-60-5 appears in our catalog under these names: 2-(5,5-Dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide, 95%, 2-(5,5-Dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide (CAS 1311316-60-5) is a chemical compound with the molecular formula C7H11N3O3 and a molecular weight of 185.18 g/mol. IUPAC name: 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide. InChIKey: NOQCJLXBVDNVFG-UHFFFAOYSA-N.
| Molecular formula | C7H11N3O3 |
|---|---|
| Molecular weight | 185.18 g/mol |
| IUPAC name | 2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide |
| InChIKey | NOQCJLXBVDNVFG-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1CC(=O)N)C |
Computed by PubChem (NCBI)