cas: 849217-48-7 — see every product listed under this CAS number, including other names
Cyclopropanecarboxylic acid, 1-[[(4-fluorophenyl)amino]carbonyl]-, 98%, 98% (CAS 849217-48-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115LL0-250mg |
| cas | 849217-48-7 |
| size | 250mg |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 50g | 213.20 Pln | |
| Chemat | 100g | 357.20 Pln | |
| Chemat | 500g | 1382.40 Pln | |
| Chemat | 1kg | 2186.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 849217-48-7) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: PFMAFXYUHZDKPY-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | PFMAFXYUHZDKPY-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)