D-Tyrosine methyl ester hydrochloride, 99%, 99%
cas: 3728-20-9 — see every product listed under this CAS number, including other names
D-Tyrosine methyl ester hydrochloride, 99%, 99% (CAS 3728-20-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145T0-1g |
| cas | 3728-20-9 |
| size | 1g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 294.80 Pln | |
| Chemat | 500g | 955.20 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 3728-20-9) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: VXYFARNRGZWHTJ-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | VXYFARNRGZWHTJ-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl D-tyrosinate hydrochloride, D-Tyrosine, methyl ester, hydrochloride, Methyl D-tyrosinate HCl, Tyrosine methylester hydrochloride, D-Tyrosine methyl ester hydrochloride, h-d-tyr-ome.hcl, H-D-Tyr-Ome HCl, methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride, H-D-Tyr-OMe hydrochloride, D-Tyrosine methyl ester HCl