h-d-tyr-ome.hcl, 97%
cas: 3728-20-9 — see every product listed under this CAS number, including other names
h-d-tyr-ome.hcl, 97% (CAS 3728-20-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045376-1G |
| cas | 3728-20-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 164.54 Pln | |
| Fluorochem | 100g | 466.52 Pln | |
| Fluorochem | 500g | 1445.34 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride (CAS 3728-20-9) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: VXYFARNRGZWHTJ-SBSPUUFOSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | VXYFARNRGZWHTJ-SBSPUUFOSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl D-tyrosinate hydrochloride, D-Tyrosine, methyl ester, hydrochloride, Methyl D-tyrosinate HCl, Tyrosine methylester hydrochloride, D-Tyrosine methyl ester hydrochloride, h-d-tyr-ome.hcl, H-D-Tyr-Ome HCl, methyl (2R)-2-amino-3-(4-hydroxyphenyl)propanoate;hydrochloride, H-D-Tyr-OMe hydrochloride, D-Tyrosine methyl ester HCl