DBCO-amine 98%
cas: 1255942-06-3 — see every product listed under this CAS number, including other names
DBCO-amine 98% (CAS 1255942-06-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A236148-25mg |
| cas | 1255942-06-3 |
| size | 25mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 325.88 Pln | |
| Ambeed | 50mg | 409.31 Pln | |
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1471.75 Pln | |
| Ambeed | 5g | 4280.81 Pln | |
| Ambeed | 10g | 7184.44 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A236148 |
3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one (CAS 1255942-06-3) is a chemical compound with the molecular formula C18H16N2O and a molecular weight of 276.3 g/mol. IUPAC name: 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one. InChIKey: OCCYFTDHSHTFER-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O |
|---|---|
| Molecular weight | 276.3 g/mol |
| IUPAC name | 3-amino-1-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)propan-1-one |
| InChIKey | OCCYFTDHSHTFER-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C#CC3=CC=CC=C3N1C(=O)CCN |
Computed by PubChem (NCBI)