CAS 187585-11-1 appears in our catalog under these names: DD1, DD1, 97%, DD1/ 99.46% (existing batch purity), DD1, ≥98%, ≥98%, DD1, 99.40%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
3-amino-2-(3-amino-4-methoxyphenyl)chromen-4-one (CAS 187585-11-1) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 3-amino-2-(3-amino-4-methoxyphenyl)chromen-4-one. InChIKey: HSRUZXHIEFFBHR-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 3-amino-2-(3-amino-4-methoxyphenyl)chromen-4-one |
| InChIKey | HSRUZXHIEFFBHR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=CC=CC=C3O2)N)N |
Computed by PubChem (NCBI)