CAS 929975-01-9 appears in our catalog under these names: 4-[(6-Methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid, 95%, 4-({6-methylimidazo(1,2-a)pyridin-2-yl}methoxy)benzoic acid, 95%, 4-({6-Methylimidazo(1,2-a)pyridin-2-yl}methoxy)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid (CAS 929975-01-9) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 4-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid. InChIKey: BFEOCPUKTFJCSJ-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]benzoic acid |
| InChIKey | BFEOCPUKTFJCSJ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C=C(N=C2C=C1)COC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)