CAS 106981-52-6 appears in our catalog under these names: 2-(4-Amino-2-ethoxyphenyl)pthalimide, 95%, 2-(4-Amino-2-ethoxyphenyl)pthalimide. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg, 50mg.
2-(4-amino-2-ethoxyphenyl)isoindole-1,3-dione (CAS 106981-52-6) is a chemical compound with the molecular formula C16H14N2O3 and a molecular weight of 282.29 g/mol. IUPAC name: 2-(4-amino-2-ethoxyphenyl)isoindole-1,3-dione. InChIKey: CWFMBSOEQIOZAR-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 2-(4-amino-2-ethoxyphenyl)isoindole-1,3-dione |
| InChIKey | CWFMBSOEQIOZAR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)N)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)